Product Name:3,3'-Dibromo-1,1'-biphenyl

IUPAC Name:3,3'-dibromo-1,1'-biphenyl

CAS:16400-51-4
Molecular Formula:C12H8Br2
Purity:95%+
Catalog Number:CM250069
Molecular Weight:312

Packing Unit Available Stock Price($) Quantity
CM250069-500g in stock Žřǟ

For R&D use only.

Inquiry Form

   refresh    

Product Details

CAS NO:16400-51-4
Molecular Formula:C12H8Br2
Melting Point:-
Smiles Code:BrC1=CC=CC(=C1)C1=CC(Br)=CC=C1
Density:
Catalog Number:CM250069
Molecular Weight:312
Boiling Point:338.6°C at 760 mmHg
MDL No:MFCD20926788
Storage:Store at room temperature.

Category Infos

Organic Light-Emitting Diode (OLED)
Organic light emitting diodes (devices) or OLEDs are monolithic solid-state devices that typically consist of a series of organic thin films sandwiched between two thin film conductive electrodes. It is a display technology used in many electronic devices, such as smartphones, televisions, and wearables. In an OLED display, each pixel is made up of organic compounds that emit light when an electric current passes through them. Unlike traditional LCD displays, this eliminates the need for a backlight. As a result, OLED displays can achieve deeper blacks and higher contrast ratios, leading to vibrant and more realistic images.

Column Infos

Benzenes
Benzene is an important organic compound with the chemical formula C6H6, and its molecule consists of a ring of 6 carbon atoms, each with 1 hydrogen atom. Benzene is a sweet, flammable, colorless and transparent liquid with carcinogenic toxicity at room temperature, and has a strong aromatic odor. It is insoluble in water, easily soluble in organic solvents, and can also be used as an organic solvent itself. The ring system of benzene is called benzene ring, and the structure after removing one hydrogen atom from the benzene ring is called phenyl. Benzene is one of the most important basic organic chemical raw materials. Many important chemical intermediates can be derived from benzene through substitution reaction, addition reaction and benzene ring cleavage reaction.


Product Other Information

Product Overview 3,3'-Dibromo-1,1'-biphenyl is a chemical compound that belongs to the class of biphenyl derivatives. It is characterized by the presence of two bromine atoms attached to the biphenyl structure. The molecular formula of 3,3'-Dibromo-1,1'-biphenyl is C12H8Br2. This chemical compound is commonly used in various industries and research fields. Its unique structure and properties make it suitable for applications such as organic synthesis, pharmaceuticals, and materials science. The presence of bromine atoms in 3,3'-Dibromo-1,1'-biphenyl contributes to its reactivity and versatility. It can undergo various chemical reactions, including substitution and coupling reactions, making it a valuable intermediate in the synthesis of more complex organic compounds. Additionally, 3,3'-Dibromo-1,1'-biphenyl has been found to exhibit interesting physical properties, such as its ability to form liquid crystalline phases. This property makes it useful in the development of liquid crystal displays (LCDs) and other electronic devices.
Chemical Properties It is a highly reactive compound due to the presence of bromine atoms. It can undergo various chemical reactions such as substitution, elimination, and coupling reactions. The compound is relatively stable under normal conditions, but it may decompose when exposed to high temperatures or strong oxidizing agents.
Applications 3,3'-Dibromo-1,1'-biphenyl has various applications in organic synthesis and material chemistry. Some of its uses include:
1. Building blocks in the synthesis of organic compounds: 3,3'-Dibromo-1,1'-biphenyl can serve as a starting material for the synthesis of more complex organic compounds through various reactions, such as Suzuki-Miyaura coupling, Heck reaction, and Buchwald-Hartwig amination.
2. Ligand in catalysis: It can be used as a ligand in transition metal-catalyzed reactions, particularly in palladium-catalyzed cross-coupling reactions.
3. OLED materials: 3,3'-Dibromo-1,1'-biphenyl derivatives have been used as building blocks for the synthesis of organic light-emitting diode (OLED) materials, which are used in display technologies.
4. Liquid crystals: Some derivatives of 3,3'-Dibromo-1,1'-biphenyl exhibit liquid crystalline properties and are used in the production of liquid crystal displays (LCDs) and other electronic devices.