Product Name:5-(2-Bromopyridin-2-yl)thiazolidine

IUPAC Name:2-bromo-5-(1,3-thiazolidin-5-yl)pyridine

CAS:1707391-27-2
Molecular Formula:C8H9BrN2S
Purity:95%+
Catalog Number:CM647440
Molecular Weight:245.14

Packing Unit Available Stock Price($) Quantity

For R&D use only.

Inquiry Form

   refresh    

Product Details

CAS NO:1707391-27-2
Molecular Formula:C8H9BrN2S
Melting Point:-
Smiles Code:BrC1=NC=C(C=C1)C1CNCS1
Density:
Catalog Number:CM647440
Molecular Weight:245.14
Boiling Point:
MDL No:
Storage:

Category Infos

Pyridines
Pyridine is a six-membered heterocyclic compound containing one nitrogen heteroatom. Pyridine and piperidine are the most frequently occurring heterocyclic building blocks in drug molecules. According to incomplete statistics, there are currently more than 180 drugs containing pyridine or piperidine structure that have been marketed, nearly 1/5 of the drugs approved for marketing in recent years contain these two structures.
Pyridine | C5H5N | Pyridine Supplier/Distributor/Manufacturer - Chemenu
Pyridine,Pyridine Wholesale,Pyridine for Sale,Pyridine Supplier,Pyridine Distributor,Pyridine Manufacturer
Pyridine is a basic heterocyclic organic compound with the chemical formula C5H5N. It is structurally related to benzene, with one methine group (=CH−) replaced by a nitrogen atom. It is a highly flammable, weakly alkaline, water-miscible liquid with a distinctive, unpleasant fish-like smell.
Thiazolidines
Thiazolidine is a heterocyclic organic compound, which is a five-membered saturated ring with a thioether group and an amine group. It is the sulfur analog of oxazolidine. Thiazolidine derivatives have many uses and have a broad spectrum of biological activities. For example, the drug pioglitazone contains a thiazolidine ring. Thiazolidine has three isomers, 2-, 3-, and 4-. Derivatives with a 2-thiazoline ring are the most common.

Related Products



Product Other Information

Product Overview The compound 5-(2-Bromopyridin-2-yl)thiazolidine is a chemical compound that belongs to the thiazolidine family. It is composed of a thiazolidine ring fused with a pyridine ring, and a bromine atom attached to the pyridine ring at the 2-position. Thiazolidines are a class of heterocyclic compounds that contain a five-membered ring with a nitrogen and a sulfur atom. They have been widely studied for their diverse biological activities and potential applications in medicinal chemistry. The presence of the bromine atom in 5-(2-Bromopyridin-2-yl)thiazolidine adds further chemical reactivity and potential for functionalization. Bromine is known for its electrophilic nature and ability to participate in various chemical reactions. The compound's structure and chemical properties make it a potentially valuable building block in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. Its unique combination of the thiazolidine and pyridine moieties may contribute to its biological activity and potential therapeutic applications.
Chemical Properties The chemical properties of 5-(2-Bromopyridin-2-yl)thiazolidine can be inferred based on its structural features. Here are some important chemical properties of this compound:
1. Functional groups: The compound contains a thiazolidine ring and a bromine atom attached to the pyridine ring. These functional groups can undergo various chemical reactions.
2. Reactivity: The presence of a bromine atom makes the compound reactive towards nucleophiles, such as amines or thiols, which can displace the bromine atom through nucleophilic substitution reactions.
3. Ring-opening reactions: The thiazolidine ring can undergo ring-opening reactions under appropriate conditions. This can lead to the formation of new compounds with different functional groups.
4. Coordination chemistry: The compound can potentially act as a ligand in coordination chemistry due to the presence of the nitrogen and sulfur atoms. This allows it to form complexes with transition metals.
5. Hydrolysis: The compound may undergo hydrolysis in the presence of water or acidic conditions, leading to the cleavage of the thiazolidine ring and the release of the corresponding acid and amine.
Applications 5-(2-Bromopyridin-2-yl)thiazolidine is a chemical compound that can have various applications in different fields. Here are a few potential applications:
1. Organic Synthesis: 5-(2-Bromopyridin-2-yl)thiazolidine can be used as a building block or starting material in organic synthesis. It can undergo various reactions, such as coupling reactions or substitution reactions, to create more complex molecules.
2. Medicinal Chemistry: Thiazolidine derivatives have been studied for their potential therapeutic applications. 5-(2-Bromopyridin-2-yl)thiazolidine can be used as a precursor to synthesize novel compounds with potential biological activities, such as antimicrobial, antiviral, or anticancer properties.
3. Agrochemicals: Thiazolidine derivatives have also been investigated for their potential use as agrochemicals, including pesticides or herbicides. 5-(2-Bromopyridin-2-yl)thiazolidine can be modified to create compounds with desired properties for crop protection.
4. Material Science: Thiazolidine derivatives can be used as ligands in coordination chemistry or as building blocks for the synthesis of functional materials. 5-(2-Bromopyridin-2-yl)thiazolidine can be incorporated into polymers or other materials to impart specific properties, such as enhanced conductivity or catalytic activity.
5. Research and Development: 5-(2-Bromopyridin-2-yl)thiazolidine can be used as a reference compound or standard in analytical chemistry or pharmaceutical research. Its properties and reactivity can be studied to understand the behavior of similar compounds or to develop new methodologies.